C20H19F4N5O2 — CID 90874819
12-[[5-fluoro-2-(trifluoromethyl)phenyl]methyl]-N-methyl-9-oxo-1,3,8,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-triene-5-carboxamide (PubChem CID 90874819) has the molecular formula C20H19F4N5O2 and a molecular weight of 437.40 g/mol. Its IUPAC name is 12-[[5-fluoro-2-(trifluoromethyl)phenyl]methyl]-N-methyl-9-oxo-1,3,8,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-triene-5-carboxamide.
| Compound Name | 12-[[5-fluoro-2-(trifluoromethyl)phenyl]methyl]-N-methyl-9-oxo-1,3,8,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-triene-5-carboxamide |
|---|---|
| PubChem CID | 90874819 |
| Molecular Formula | C20H19F4N5O2 |
| Molecular Weight | 437.40 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | 12-[[5-fluoro-2-(trifluoromethyl)phenyl]methyl]-N-methyl-9-oxo-1,3,8,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-triene-5-carboxamide |
| SMILES | CNC(=O)c1cnc2c(c1)NC(=O)C1CN(Cc3cc(F)ccc3C(F)(F)F)CCN21 |
| InChI | InChI=1S/C20H19F4N5O2/c1-25-18(30)11-7-15-17(26-8-11)29-5-4-28(10-16(29)19(31)27-15)9-12-6-13(21)2-3-14(12)20(22,23)24/h2-3,6-8,16H,4-5,9-10H2,1H3,(H,25,30)(H,27,31) |
| InChIKey | ZADLIAZUCQDUTR-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.40 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |