C21H21F4N5O2 — CID 91175716
N-ethyl-12-[[5-fluoro-2-(trifluoromethyl)phenyl]methyl]-9-oxo-1,3,8,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-triene-5-carboxamide (PubChem CID 91175716) has the molecular formula C21H21F4N5O2 and a molecular weight of 451.42 g/mol. Its IUPAC name is N-ethyl-12-[[5-fluoro-2-(trifluoromethyl)phenyl]methyl]-9-oxo-1,3,8,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-triene-5-carboxamide.
| Compound Name | N-ethyl-12-[[5-fluoro-2-(trifluoromethyl)phenyl]methyl]-9-oxo-1,3,8,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-triene-5-carboxamide |
|---|---|
| PubChem CID | 91175716 |
| Molecular Formula | C21H21F4N5O2 |
| Molecular Weight | 451.42 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | N-ethyl-12-[[5-fluoro-2-(trifluoromethyl)phenyl]methyl]-9-oxo-1,3,8,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-triene-5-carboxamide |
| SMILES | CCNC(=O)c1cnc2c(c1)NC(=O)C1CN(Cc3cc(F)ccc3C(F)(F)F)CCN21 |
| InChI | InChI=1S/C21H21F4N5O2/c1-2-26-19(31)12-8-16-18(27-9-12)30-6-5-29(11-17(30)20(32)28-16)10-13-7-14(22)3-4-15(13)21(23,24)25/h3-4,7-9,17H,2,5-6,10-11H2,1H3,(H,26,31)(H,28,32) |
| InChIKey | JPNPEKJQGHHNPY-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.42 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |