C7H14F4N+ — CID 163324383
ethyl-dimethyl-(2,2,3,3-tetrafluoropropyl)azanium (PubChem CID 163324383) has the molecular formula C7H14F4N+ and a molecular weight of 188.19 g/mol. Its IUPAC name is ethyl-dimethyl-(2,2,3,3-tetrafluoropropyl)azanium.
| Compound Name | ethyl-dimethyl-(2,2,3,3-tetrafluoropropyl)azanium |
|---|---|
| PubChem CID | 163324383 |
| Molecular Formula | C7H14F4N+ |
| Molecular Weight | 188.19 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | ethyl-dimethyl-(2,2,3,3-tetrafluoropropyl)azanium |
| SMILES | CC[N+](C)(C)CC(F)(F)C(F)F |
| InChI | InChI=1S/C7H14F4N/c1-4-12(2,3)5-7(10,11)6(8)9/h6H,4-5H2,1-3H3/q+1 |
| InChIKey | JPIFTWNXYGHWSP-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.19 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|