C21H18ClN5O2S — CID 163326791
4-[2-[(E)-2-cyano-2-(6-methyl-1H-benzimidazol-2-yl)ethenyl]pyrrol-1-yl]benzenesulfonamide;hydrochloride (PubChem CID 163326791) has the molecular formula C21H18ClN5O2S and a molecular weight of 439.93 g/mol. Its IUPAC name is 4-[2-[(E)-2-cyano-2-(6-methyl-1H-benzimidazol-2-yl)ethenyl]pyrrol-1-yl]benzenesulfonamide;hydrochloride.
| Compound Name | 4-[2-[(E)-2-cyano-2-(6-methyl-1H-benzimidazol-2-yl)ethenyl]pyrrol-1-yl]benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 163326791 |
| Molecular Formula | C21H18ClN5O2S |
| Molecular Weight | 439.93 g/mol |
| Exact Mass | 439.09 |
| IUPAC Name | 4-[2-[(E)-2-cyano-2-(6-methyl-1H-benzimidazol-2-yl)ethenyl]pyrrol-1-yl]benzenesulfonamide;hydrochloride |
| SMILES | Cc1ccc2nc(/C(C#N)=C/c3cccn3-c3ccc(S(N)(=O)=O)cc3)[nH]c2c1.Cl |
| InChI | InChI=1S/C21H17N5O2S.ClH/c1-14-4-9-19-20(11-14)25-21(24-19)15(13-22)12-17-3-2-10-26(17)16-5-7-18(8-6-16)29(23,27)28;/h2-12H,1H3,(H,24,25)(H2,23,27,28);1H/b15-12+; |
| InChIKey | RDGQGTLCPYPDQE-JRUHLWALSA-N |
| XLogP | 3.80 |
| TPSA | 117.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.93 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|