C21H15FN4 — CID 4021162
3-[1-(4-fluorophenyl)pyrrol-2-yl]-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile (PubChem CID 4021162) has the molecular formula C21H15FN4 and a molecular weight of 342.38 g/mol. Its IUPAC name is 3-[1-(4-fluorophenyl)pyrrol-2-yl]-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile.
| Compound Name | 3-[1-(4-fluorophenyl)pyrrol-2-yl]-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 4021162 |
| Molecular Formula | C21H15FN4 |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 3-[1-(4-fluorophenyl)pyrrol-2-yl]-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile |
| SMILES | Cc1ccc2nc(C(C#N)=Cc3cccn3-c3ccc(F)cc3)[nH]c2c1 |
| InChI | InChI=1S/C21H15FN4/c1-14-4-9-19-20(11-14)25-21(24-19)15(13-23)12-18-3-2-10-26(18)17-7-5-16(22)6-8-17/h2-12H,1H3,(H,24,25) |
| InChIKey | OESJSZCJUVCKHH-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 57.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|