C19H19N5O5S2 — CID 163330265
N-(5-acetamido-4-thiophen-2-yl-1,3-thiazol-2-yl)-4-nitrobenzamide;N,N-dimethylformamide (PubChem CID 163330265) has the molecular formula C19H19N5O5S2 and a molecular weight of 461.53 g/mol. Its IUPAC name is N-(5-acetamido-4-thiophen-2-yl-1,3-thiazol-2-yl)-4-nitrobenzamide;N,N-dimethylformamide.
| Compound Name | N-(5-acetamido-4-thiophen-2-yl-1,3-thiazol-2-yl)-4-nitrobenzamide;N,N-dimethylformamide |
|---|---|
| PubChem CID | 163330265 |
| Molecular Formula | C19H19N5O5S2 |
| Molecular Weight | 461.53 g/mol |
| Exact Mass | 461.08 |
| IUPAC Name | N-(5-acetamido-4-thiophen-2-yl-1,3-thiazol-2-yl)-4-nitrobenzamide;N,N-dimethylformamide |
| SMILES | CC(=O)Nc1sc(NC(=O)c2ccc([N+](=O)[O-])cc2)nc1-c1cccs1.CN(C)C=O |
| InChI | InChI=1S/C16H12N4O4S2.C3H7NO/c1-9(21)17-15-13(12-3-2-8-25-12)18-16(26-15)19-14(22)10-4-6-11(7-5-10)20(23)24;1-4(2)3-5/h2-8H,1H3,(H,17,21)(H,18,19,22);3H,1-2H3 |
| InChIKey | RVUBHPDIZAPPNU-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 134.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.53 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|