C17H27Cl2NO4 — CID 163337708
ethyl 2-[2-chloro-6-ethoxy-4-(propylaminomethyl)phenoxy]propanoate;hydrochloride (PubChem CID 163337708) has the molecular formula C17H27Cl2NO4 and a molecular weight of 380.31 g/mol. Its IUPAC name is ethyl 2-[2-chloro-6-ethoxy-4-(propylaminomethyl)phenoxy]propanoate;hydrochloride.
| Compound Name | ethyl 2-[2-chloro-6-ethoxy-4-(propylaminomethyl)phenoxy]propanoate;hydrochloride |
|---|---|
| PubChem CID | 163337708 |
| Molecular Formula | C17H27Cl2NO4 |
| Molecular Weight | 380.31 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | ethyl 2-[2-chloro-6-ethoxy-4-(propylaminomethyl)phenoxy]propanoate;hydrochloride |
| SMILES | CCCNCc1cc(Cl)c(OC(C)C(=O)OCC)c(OCC)c1.Cl |
| InChI | InChI=1S/C17H26ClNO4.ClH/c1-5-8-19-11-13-9-14(18)16(15(10-13)21-6-2)23-12(4)17(20)22-7-3;/h9-10,12,19H,5-8,11H2,1-4H3;1H |
| InChIKey | ACYAQQKQXVBOSG-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.31 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|