C20H27FN2O7 — CID 163337923
4-fluoro-N-[(1R,2R,4S)-2-hydroxy-4-(oxan-4-ylcarbamoyl)cyclopentyl]-2-methoxybenzamide;formic acid (PubChem CID 163337923) has the molecular formula C20H27FN2O7 and a molecular weight of 426.44 g/mol. Its IUPAC name is 4-fluoro-N-[(1R,2R,4S)-2-hydroxy-4-(oxan-4-ylcarbamoyl)cyclopentyl]-2-methoxybenzamide;formic acid.
| Compound Name | 4-fluoro-N-[(1R,2R,4S)-2-hydroxy-4-(oxan-4-ylcarbamoyl)cyclopentyl]-2-methoxybenzamide;formic acid |
|---|---|
| PubChem CID | 163337923 |
| Molecular Formula | C20H27FN2O7 |
| Molecular Weight | 426.44 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 4-fluoro-N-[(1R,2R,4S)-2-hydroxy-4-(oxan-4-ylcarbamoyl)cyclopentyl]-2-methoxybenzamide;formic acid |
| SMILES | COc1cc(F)ccc1C(=O)N[C@@H]1C[C@H](C(=O)NC2CCOCC2)C[C@H]1O.O=CO |
| InChI | InChI=1S/C19H25FN2O5.CH2O2/c1-26-17-10-12(20)2-3-14(17)19(25)22-15-8-11(9-16(15)23)18(24)21-13-4-6-27-7-5-13;2-1-3/h2-3,10-11,13,15-16,23H,4-9H2,1H3,(H,21,24)(H,22,25);1H,(H,2,3)/t11-,15+,16+;/m0./s1 |
| InChIKey | CFAPHVQUTGEGTH-SLNIVHKSSA-N |
| XLogP | 0.70 |
| TPSA | 134.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.44 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|