C20H28ClN3O6 — CID 163340514
3-chloro-N-[(1S,2S,4S)-2-hydroxy-4-(2-hydroxyethylcarbamoyl)cyclopentyl]-4-pyrrolidin-1-ylbenzamide;formic acid (PubChem CID 163340514) has the molecular formula C20H28ClN3O6 and a molecular weight of 441.91 g/mol. Its IUPAC name is 3-chloro-N-[(1S,2S,4S)-2-hydroxy-4-(2-hydroxyethylcarbamoyl)cyclopentyl]-4-pyrrolidin-1-ylbenzamide;formic acid.
| Compound Name | 3-chloro-N-[(1S,2S,4S)-2-hydroxy-4-(2-hydroxyethylcarbamoyl)cyclopentyl]-4-pyrrolidin-1-ylbenzamide;formic acid |
|---|---|
| PubChem CID | 163340514 |
| Molecular Formula | C20H28ClN3O6 |
| Molecular Weight | 441.91 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | 3-chloro-N-[(1S,2S,4S)-2-hydroxy-4-(2-hydroxyethylcarbamoyl)cyclopentyl]-4-pyrrolidin-1-ylbenzamide;formic acid |
| SMILES | O=C(N[C@H]1C[C@H](C(=O)NCCO)C[C@@H]1O)c1ccc(N2CCCC2)c(Cl)c1.O=CO |
| InChI | InChI=1S/C19H26ClN3O4.CH2O2/c20-14-9-12(3-4-16(14)23-6-1-2-7-23)19(27)22-15-10-13(11-17(15)25)18(26)21-5-8-24;2-1-3/h3-4,9,13,15,17,24-25H,1-2,5-8,10-11H2,(H,21,26)(H,22,27);1H,(H,2,3)/t13-,15-,17-;/m0./s1 |
| InChIKey | FJGHDCUKLIHECI-FWBJMGQWSA-N |
| XLogP | 0.62 |
| TPSA | 139.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.91 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|