C18H15FN2O4 — CID 163367449
N-[4-(7-fluoro-1,3-benzoxazol-2-yl)phenyl]-1,4-dioxane-2-carboxamide (PubChem CID 163367449) has the molecular formula C18H15FN2O4 and a molecular weight of 342.33 g/mol. Its IUPAC name is N-[4-(7-fluoro-1,3-benzoxazol-2-yl)phenyl]-1,4-dioxane-2-carboxamide.
| Compound Name | N-[4-(7-fluoro-1,3-benzoxazol-2-yl)phenyl]-1,4-dioxane-2-carboxamide |
|---|---|
| PubChem CID | 163367449 |
| Molecular Formula | C18H15FN2O4 |
| Molecular Weight | 342.33 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | N-[4-(7-fluoro-1,3-benzoxazol-2-yl)phenyl]-1,4-dioxane-2-carboxamide |
| SMILES | O=C(Nc1ccc(-c2nc3cccc(F)c3o2)cc1)C1COCCO1 |
| InChI | InChI=1S/C18H15FN2O4/c19-13-2-1-3-14-16(13)25-18(21-14)11-4-6-12(7-5-11)20-17(22)15-10-23-8-9-24-15/h1-7,15H,8-10H2,(H,20,22) |
| InChIKey | YRJOBQXRRRUBME-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.33 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |