C16H16FN5 — CID 163369445
6-(5-amino-2-fluoro-4-methylphenyl)-N,7-dimethylpyrido[2,3-d]pyrimidin-2-amine (PubChem CID 163369445) has the molecular formula C16H16FN5 and a molecular weight of 297.34 g/mol. Its IUPAC name is 6-(5-amino-2-fluoro-4-methylphenyl)-N,7-dimethylpyrido[2,3-d]pyrimidin-2-amine.
| Compound Name | 6-(5-amino-2-fluoro-4-methylphenyl)-N,7-dimethylpyrido[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 163369445 |
| Molecular Formula | C16H16FN5 |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 6-(5-amino-2-fluoro-4-methylphenyl)-N,7-dimethylpyrido[2,3-d]pyrimidin-2-amine |
| SMILES | CNc1ncc2cc(-c3cc(N)c(C)cc3F)c(C)nc2n1 |
| InChI | InChI=1S/C16H16FN5/c1-8-4-13(17)12(6-14(8)18)11-5-10-7-20-16(19-3)22-15(10)21-9(11)2/h4-7H,18H2,1-3H3,(H,19,20,21,22) |
| InChIKey | BSSPZBPTTWAPJF-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|