C21H29NO5 — CID 163370856
tert-butyl 3-(2-ethoxy-2-oxoethyl)-5-(4-formylphenyl)piperidine-1-carboxylate (PubChem CID 163370856) has the molecular formula C21H29NO5 and a molecular weight of 375.47 g/mol. Its IUPAC name is tert-butyl 3-(2-ethoxy-2-oxoethyl)-5-(4-formylphenyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-(2-ethoxy-2-oxoethyl)-5-(4-formylphenyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 163370856 |
| Molecular Formula | C21H29NO5 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | tert-butyl 3-(2-ethoxy-2-oxoethyl)-5-(4-formylphenyl)piperidine-1-carboxylate |
| SMILES | CCOC(=O)CC1CC(c2ccc(C=O)cc2)CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C21H29NO5/c1-5-26-19(24)11-16-10-18(17-8-6-15(14-23)7-9-17)13-22(12-16)20(25)27-21(2,3)4/h6-9,14,16,18H,5,10-13H2,1-4H3 |
| InChIKey | WTFUOIJVZUTHQJ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|