C13H22BrN — CID 163375562
2-bromo-1,3-dimethylbenzene;N,N-dimethylpropan-1-amine (PubChem CID 163375562) has the molecular formula C13H22BrN and a molecular weight of 272.23 g/mol. Its IUPAC name is 2-bromo-1,3-dimethylbenzene;N,N-dimethylpropan-1-amine.
| Compound Name | 2-bromo-1,3-dimethylbenzene;N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 163375562 |
| Molecular Formula | C13H22BrN |
| Molecular Weight | 272.23 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | 2-bromo-1,3-dimethylbenzene;N,N-dimethylpropan-1-amine |
| SMILES | CCCN(C)C.Cc1cccc(C)c1Br |
| InChI | InChI=1S/C8H9Br.C5H13N/c1-6-4-3-5-7(2)8(6)9;1-4-5-6(2)3/h3-5H,1-2H3;4-5H2,1-3H3 |
| InChIKey | KRURPMIPGHKPTN-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.23 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |