C8H5Cl2FIN2P — CID 163388873
(3,5-dichloro-7-fluoro-4-methylindazol-1-yl)-iodophosphane (PubChem CID 163388873) has the molecular formula C8H5Cl2FIN2P and a molecular weight of 376.92 g/mol. Its IUPAC name is (3,5-dichloro-7-fluoro-4-methylindazol-1-yl)-iodophosphane.
| Compound Name | (3,5-dichloro-7-fluoro-4-methylindazol-1-yl)-iodophosphane |
|---|---|
| PubChem CID | 163388873 |
| Molecular Formula | C8H5Cl2FIN2P |
| Molecular Weight | 376.92 g/mol |
| Exact Mass | 375.86 |
| IUPAC Name | (3,5-dichloro-7-fluoro-4-methylindazol-1-yl)-iodophosphane |
| SMILES | Cc1c(Cl)cc(F)c2c1c(Cl)nn2PI |
| InChI | InChI=1S/C8H5Cl2FIN2P/c1-3-4(9)2-5(11)7-6(3)8(10)13-14(7)15-12/h2,15H,1H3 |
| InChIKey | YPAYAAQYUPEPKW-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.92 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|