C30H57N3O2 — CID 163389061
N'-(3-aminopropyl)-N'-[3,5-bis(2-ethylhexoxy)phenyl]pentane-1,5-diamine (PubChem CID 163389061) has the molecular formula C30H57N3O2 and a molecular weight of 491.81 g/mol. Its IUPAC name is N'-(3-aminopropyl)-N'-[3,5-bis(2-ethylhexoxy)phenyl]pentane-1,5-diamine.
| Compound Name | N'-(3-aminopropyl)-N'-[3,5-bis(2-ethylhexoxy)phenyl]pentane-1,5-diamine |
|---|---|
| PubChem CID | 163389061 |
| Molecular Formula | C30H57N3O2 |
| Molecular Weight | 491.81 g/mol |
| Exact Mass | 491.45 |
| IUPAC Name | N'-(3-aminopropyl)-N'-[3,5-bis(2-ethylhexoxy)phenyl]pentane-1,5-diamine |
| SMILES | CCCCC(CC)COc1cc(OCC(CC)CCCC)cc(N(CCCN)CCCCCN)c1 |
| InChI | InChI=1S/C30H57N3O2/c1-5-9-15-26(7-3)24-34-29-21-28(33(20-14-18-32)19-13-11-12-17-31)22-30(23-29)35-25-27(8-4)16-10-6-2/h21-23,26-27H,5-20,24-25,31-32H2,1-4H3 |
| InChIKey | UWXBYZKNABSWCK-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.81 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|