C21H38N2 — CID 163389680
butan-2-yl-[(3Z,5E,7E)-2,5,8,9-tetramethyl-6-propan-2-yldeca-3,5,7-trien-3-yl]diazene (PubChem CID 163389680) has the molecular formula C21H38N2 and a molecular weight of 318.55 g/mol. Its IUPAC name is butan-2-yl-[(3Z,5E,7E)-2,5,8,9-tetramethyl-6-propan-2-yldeca-3,5,7-trien-3-yl]diazene.
| Compound Name | butan-2-yl-[(3Z,5E,7E)-2,5,8,9-tetramethyl-6-propan-2-yldeca-3,5,7-trien-3-yl]diazene |
|---|---|
| PubChem CID | 163389680 |
| Molecular Formula | C21H38N2 |
| Molecular Weight | 318.55 g/mol |
| Exact Mass | 318.30 |
| IUPAC Name | butan-2-yl-[(3Z,5E,7E)-2,5,8,9-tetramethyl-6-propan-2-yldeca-3,5,7-trien-3-yl]diazene |
| SMILES | CCC(C)/N=N/C(=C\C(C)=C(\C=C(/C)C(C)C)C(C)C)C(C)C |
| InChI | InChI=1S/C21H38N2/c1-11-19(10)22-23-21(16(6)7)13-18(9)20(15(4)5)12-17(8)14(2)3/h12-16,19H,11H2,1-10H3/b17-12+,20-18-,21-13-,23-22+ |
| InChIKey | YWRKFWNPTBWTKD-XBGVEQLISA-N |
| XLogP | 7.35 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.55 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|