C16H17FN2O3 — CID 163394349
(E)-3-[3-[(3aS,7aR)-7a-fluoro-1-oxo-3,3a,4,5,6,7-hexahydropyrrolo[3,4-c]pyridin-2-yl]phenyl]prop-2-enoic acid (PubChem CID 163394349) has the molecular formula C16H17FN2O3 and a molecular weight of 304.32 g/mol. Its IUPAC name is (E)-3-[3-[(3aS,7aR)-7a-fluoro-1-oxo-3,3a,4,5,6,7-hexahydropyrrolo[3,4-c]pyridin-2-yl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-[(3aS,7aR)-7a-fluoro-1-oxo-3,3a,4,5,6,7-hexahydropyrrolo[3,4-c]pyridin-2-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 163394349 |
| Molecular Formula | C16H17FN2O3 |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | (E)-3-[3-[(3aS,7aR)-7a-fluoro-1-oxo-3,3a,4,5,6,7-hexahydropyrrolo[3,4-c]pyridin-2-yl]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cccc(N2C[C@@H]3CNCC[C@]3(F)C2=O)c1 |
| InChI | InChI=1S/C16H17FN2O3/c17-16-6-7-18-9-12(16)10-19(15(16)22)13-3-1-2-11(8-13)4-5-14(20)21/h1-5,8,12,18H,6-7,9-10H2,(H,20,21)/b5-4+/t12-,16+/m0/s1 |
| InChIKey | KWLODKFIVIRLIL-GKNQGBKISA-N |
| XLogP | 1.45 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|