C22H20F3N5O — CID 163399648
1-[4-[4-cyano-3-(trifluoromethyl)anilino]cyclohexyl]indazole-4-carboxamide (PubChem CID 163399648) has the molecular formula C22H20F3N5O and a molecular weight of 427.43 g/mol. Its IUPAC name is 1-[4-[4-cyano-3-(trifluoromethyl)anilino]cyclohexyl]indazole-4-carboxamide.
| Compound Name | 1-[4-[4-cyano-3-(trifluoromethyl)anilino]cyclohexyl]indazole-4-carboxamide |
|---|---|
| PubChem CID | 163399648 |
| Molecular Formula | C22H20F3N5O |
| Molecular Weight | 427.43 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | 1-[4-[4-cyano-3-(trifluoromethyl)anilino]cyclohexyl]indazole-4-carboxamide |
| SMILES | N#Cc1ccc(NC2CCC(n3ncc4c(C(N)=O)cccc43)CC2)cc1C(F)(F)F |
| InChI | InChI=1S/C22H20F3N5O/c23-22(24,25)19-10-15(5-4-13(19)11-26)29-14-6-8-16(9-7-14)30-20-3-1-2-17(21(27)31)18(20)12-28-30/h1-5,10,12,14,16,29H,6-9H2,(H2,27,31) |
| InChIKey | BQLGDJJRMNJAQJ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 96.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.43 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |