C37H32ClN7O4S — CID 163403966
N-[3-[[4-[1-(benzenesulfonyl)indol-3-yl]-5-chloropyrimidin-2-yl]amino]phenyl]-4-[[(E)-4-(ethylamino)but-2-enoyl]amino]benzamide (PubChem CID 163403966) has the molecular formula C37H32ClN7O4S and a molecular weight of 706.23 g/mol. Its IUPAC name is N-[3-[[4-[1-(benzenesulfonyl)indol-3-yl]-5-chloropyrimidin-2-yl]amino]phenyl]-4-[[(E)-4-(ethylamino)but-2-enoyl]amino]benzamide.
| Compound Name | N-[3-[[4-[1-(benzenesulfonyl)indol-3-yl]-5-chloropyrimidin-2-yl]amino]phenyl]-4-[[(E)-4-(ethylamino)but-2-enoyl]amino]benzamide |
|---|---|
| PubChem CID | 163403966 |
| Molecular Formula | C37H32ClN7O4S |
| Molecular Weight | 706.23 g/mol |
| Exact Mass | 705.19 |
| IUPAC Name | N-[3-[[4-[1-(benzenesulfonyl)indol-3-yl]-5-chloropyrimidin-2-yl]amino]phenyl]-4-[[(E)-4-(ethylamino)but-2-enoyl]amino]benzamide |
| SMILES | CCNC/C=C/C(=O)Nc1ccc(C(=O)Nc2cccc(Nc3ncc(Cl)c(-c4cn(S(=O)(=O)c5ccccc5)c5ccccc45)n3)c2)cc1 |
| InChI | InChI=1S/C37H32ClN7O4S/c1-2-39-21-9-16-34(46)41-26-19-17-25(18-20-26)36(47)42-27-10-8-11-28(22-27)43-37-40-23-32(38)35(44-37)31-24-45(33-15-7-6-14-30(31)33)50(48,49)29-12-4-3-5-13-29/h3-20,22-24,39H,2,21H2,1H3,(H,41,46)(H,42,47)(H,40,43,44)/b16-9+ |
| InChIKey | JCVYYSGRKKCKGL-CXUHLZMHSA-N |
| XLogP | 7.09 |
| TPSA | 147.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.23 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|