C32H25ClN6O3S — CID 90101931
4-amino-N-[3-[[4-[1-(benzenesulfonyl)indol-3-yl]-5-chloropyrimidin-2-yl]amino]phenyl]-N-methylbenzamide (PubChem CID 90101931) has the molecular formula C32H25ClN6O3S and a molecular weight of 609.11 g/mol. Its IUPAC name is 4-amino-N-[3-[[4-[1-(benzenesulfonyl)indol-3-yl]-5-chloropyrimidin-2-yl]amino]phenyl]-N-methylbenzamide.
| Compound Name | 4-amino-N-[3-[[4-[1-(benzenesulfonyl)indol-3-yl]-5-chloropyrimidin-2-yl]amino]phenyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 90101931 |
| Molecular Formula | C32H25ClN6O3S |
| Molecular Weight | 609.11 g/mol |
| Exact Mass | 608.14 |
| IUPAC Name | 4-amino-N-[3-[[4-[1-(benzenesulfonyl)indol-3-yl]-5-chloropyrimidin-2-yl]amino]phenyl]-N-methylbenzamide |
| SMILES | CN(C(=O)c1ccc(N)cc1)c1cccc(Nc2ncc(Cl)c(-c3cn(S(=O)(=O)c4ccccc4)c4ccccc34)n2)c1 |
| InChI | InChI=1S/C32H25ClN6O3S/c1-38(31(40)21-14-16-22(34)17-15-21)24-9-7-8-23(18-24)36-32-35-19-28(33)30(37-32)27-20-39(29-13-6-5-12-26(27)29)43(41,42)25-10-3-2-4-11-25/h2-20H,34H2,1H3,(H,35,36,37) |
| InChIKey | JSIGROKWYDNUPQ-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 123.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.11 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|