C24H17ClO3 — CID 163406296
(14-chloro-10-phenoxy-3-tetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10,13-hexaenyl) prop-2-enoate (PubChem CID 163406296) has the molecular formula C24H17ClO3 and a molecular weight of 388.85 g/mol. Its IUPAC name is (14-chloro-10-phenoxy-3-tetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10,13-hexaenyl) prop-2-enoate.
| Compound Name | (14-chloro-10-phenoxy-3-tetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10,13-hexaenyl) prop-2-enoate |
|---|---|
| PubChem CID | 163406296 |
| Molecular Formula | C24H17ClO3 |
| Molecular Weight | 388.85 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | (14-chloro-10-phenoxy-3-tetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10,13-hexaenyl) prop-2-enoate |
| SMILES | C=CC(=O)Oc1c2c(c(Oc3ccccc3)c3ccccc13)C1C=C(Cl)C2C1 |
| InChI | InChI=1S/C24H17ClO3/c1-2-20(26)28-24-17-11-7-6-10-16(17)23(27-15-8-4-3-5-9-15)21-14-12-18(22(21)24)19(25)13-14/h2-11,13-14,18H,1,12H2 |
| InChIKey | PHPZXYMZVLWZBY-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.85 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|