C19H15ClO3 — CID 163406993
(14-chloro-10-hydroxy-7-methyl-3-tetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10,13-hexaenyl) prop-2-enoate (PubChem CID 163406993) has the molecular formula C19H15ClO3 and a molecular weight of 326.78 g/mol. Its IUPAC name is (14-chloro-10-hydroxy-7-methyl-3-tetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10,13-hexaenyl) prop-2-enoate.
| Compound Name | (14-chloro-10-hydroxy-7-methyl-3-tetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10,13-hexaenyl) prop-2-enoate |
|---|---|
| PubChem CID | 163406993 |
| Molecular Formula | C19H15ClO3 |
| Molecular Weight | 326.78 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | (14-chloro-10-hydroxy-7-methyl-3-tetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10,13-hexaenyl) prop-2-enoate |
| SMILES | C=CC(=O)Oc1c2c(c(O)c3cc(C)ccc13)C1C=C(Cl)C2C1 |
| InChI | InChI=1S/C19H15ClO3/c1-3-15(21)23-19-11-5-4-9(2)6-12(11)18(22)16-10-7-13(17(16)19)14(20)8-10/h3-6,8,10,13,22H,1,7H2,2H3 |
| InChIKey | ATASCJPPWLOVME-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.78 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|