C19H18O3 — CID 163406678
(10-hydroxy-2,6-dimethyl-1,4-dihydroanthracen-9-yl) prop-2-enoate (PubChem CID 163406678) has the molecular formula C19H18O3 and a molecular weight of 294.35 g/mol. Its IUPAC name is (10-hydroxy-2,6-dimethyl-1,4-dihydroanthracen-9-yl) prop-2-enoate.
| Compound Name | (10-hydroxy-2,6-dimethyl-1,4-dihydroanthracen-9-yl) prop-2-enoate |
|---|---|
| PubChem CID | 163406678 |
| Molecular Formula | C19H18O3 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | (10-hydroxy-2,6-dimethyl-1,4-dihydroanthracen-9-yl) prop-2-enoate |
| SMILES | C=CC(=O)Oc1c2c(c(O)c3cc(C)ccc13)CC=C(C)C2 |
| InChI | InChI=1S/C19H18O3/c1-4-17(20)22-19-14-8-6-11(2)9-15(14)18(21)13-7-5-12(3)10-16(13)19/h4-6,8-9,21H,1,7,10H2,2-3H3 |
| InChIKey | KIPUTWWPAOWHJD-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|