C27H24O3 — CID 163406906
(14-ethyl-7-methyl-10-phenoxy-3-tetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10,13-hexaenyl) prop-2-enoate (PubChem CID 163406906) has the molecular formula C27H24O3 and a molecular weight of 396.49 g/mol. Its IUPAC name is (14-ethyl-7-methyl-10-phenoxy-3-tetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10,13-hexaenyl) prop-2-enoate.
| Compound Name | (14-ethyl-7-methyl-10-phenoxy-3-tetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10,13-hexaenyl) prop-2-enoate |
|---|---|
| PubChem CID | 163406906 |
| Molecular Formula | C27H24O3 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | (14-ethyl-7-methyl-10-phenoxy-3-tetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10,13-hexaenyl) prop-2-enoate |
| SMILES | C=CC(=O)Oc1c2c(c(Oc3ccccc3)c3cc(C)ccc13)C1C=C(CC)C2C1 |
| InChI | InChI=1S/C27H24O3/c1-4-17-14-18-15-21(17)25-24(18)27(29-19-9-7-6-8-10-19)22-13-16(3)11-12-20(22)26(25)30-23(28)5-2/h5-14,18,21H,2,4,15H2,1,3H3 |
| InChIKey | COCPGQHJLVRHGG-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|