C14H15FN2O5S — CID 163408003
8-(3-fluorophenyl)sulfonyl-3-hydroxy-4a,5,6,7,8,8a-hexahydro-1H-quinazoline-2,4-dione (PubChem CID 163408003) has the molecular formula C14H15FN2O5S and a molecular weight of 342.35 g/mol. Its IUPAC name is 8-(3-fluorophenyl)sulfonyl-3-hydroxy-4a,5,6,7,8,8a-hexahydro-1H-quinazoline-2,4-dione.
| Compound Name | 8-(3-fluorophenyl)sulfonyl-3-hydroxy-4a,5,6,7,8,8a-hexahydro-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 163408003 |
| Molecular Formula | C14H15FN2O5S |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | 8-(3-fluorophenyl)sulfonyl-3-hydroxy-4a,5,6,7,8,8a-hexahydro-1H-quinazoline-2,4-dione |
| SMILES | O=C1NC2C(CCCC2S(=O)(=O)c2cccc(F)c2)C(=O)N1O |
| InChI | InChI=1S/C14H15FN2O5S/c15-8-3-1-4-9(7-8)23(21,22)11-6-2-5-10-12(11)16-14(19)17(20)13(10)18/h1,3-4,7,10-12,20H,2,5-6H2,(H,16,19) |
| InChIKey | KUKKSLGMVPWIFF-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|