C30H32N2O4Se — CID 163408875
methyl 2-[2,5-dioxo-4,4-diphenyl-3-(6-phenylselanylhexyl)imidazolidin-1-yl]acetate (PubChem CID 163408875) has the molecular formula C30H32N2O4Se and a molecular weight of 563.56 g/mol. Its IUPAC name is methyl 2-[2,5-dioxo-4,4-diphenyl-3-(6-phenylselanylhexyl)imidazolidin-1-yl]acetate.
| Compound Name | methyl 2-[2,5-dioxo-4,4-diphenyl-3-(6-phenylselanylhexyl)imidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 163408875 |
| Molecular Formula | C30H32N2O4Se |
| Molecular Weight | 563.56 g/mol |
| Exact Mass | 564.15 |
| IUPAC Name | methyl 2-[2,5-dioxo-4,4-diphenyl-3-(6-phenylselanylhexyl)imidazolidin-1-yl]acetate |
| SMILES | COC(=O)CN1C(=O)N(CCCCCC[Se]c2ccccc2)C(c2ccccc2)(c2ccccc2)C1=O |
| InChI | InChI=1S/C30H32N2O4Se/c1-36-27(33)23-31-28(34)30(24-15-7-4-8-16-24,25-17-9-5-10-18-25)32(29(31)35)21-13-2-3-14-22-37-26-19-11-6-12-20-26/h4-12,15-20H,2-3,13-14,21-23H2,1H3 |
| InChIKey | KOMRNQCZULYKIK-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.56 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|