C10H18N2 — CID 163416173
(4S)-4-ethyl-1-methyl-2,4,5,6,7,7a-hexahydroindazole (PubChem CID 163416173) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is (4S)-4-ethyl-1-methyl-2,4,5,6,7,7a-hexahydroindazole.
| Compound Name | (4S)-4-ethyl-1-methyl-2,4,5,6,7,7a-hexahydroindazole |
|---|---|
| PubChem CID | 163416173 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | (4S)-4-ethyl-1-methyl-2,4,5,6,7,7a-hexahydroindazole |
| SMILES | CC[C@H]1CCCC2C1=CNN2C |
| InChI | InChI=1S/C10H18N2/c1-3-8-5-4-6-10-9(8)7-11-12(10)2/h7-8,10-11H,3-6H2,1-2H3/t8-,10?/m0/s1 |
| InChIKey | AEPIUZZRFHUZAR-PEHGTWAWSA-N |
| XLogP | 1.90 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |