C19H24BF3N2O — CID 163421062
[1-[(2-azaniumyl-3-phenylpropanoyl)amino]-4-phenylbutan-2-yl]-trifluoroboranuide (PubChem CID 163421062) has the molecular formula C19H24BF3N2O and a molecular weight of 364.22 g/mol. Its IUPAC name is [1-[(2-azaniumyl-3-phenylpropanoyl)amino]-4-phenylbutan-2-yl]-trifluoroboranuide.
| Compound Name | [1-[(2-azaniumyl-3-phenylpropanoyl)amino]-4-phenylbutan-2-yl]-trifluoroboranuide |
|---|---|
| PubChem CID | 163421062 |
| Molecular Formula | C19H24BF3N2O |
| Molecular Weight | 364.22 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | [1-[(2-azaniumyl-3-phenylpropanoyl)amino]-4-phenylbutan-2-yl]-trifluoroboranuide |
| SMILES | [NH3+]C(Cc1ccccc1)C(=O)NCC(CCc1ccccc1)[B-](F)(F)F |
| InChI | InChI=1S/C19H23BF3N2O/c21-20(22,23)17(12-11-15-7-3-1-4-8-15)14-25-19(26)18(24)13-16-9-5-2-6-10-16/h1-10,17-18H,11-14,24H2,(H,25,26)/q-1/p+1 |
| InChIKey | AIMRTZPIAMDBQZ-UHFFFAOYSA-O |
| XLogP | 2.81 |
| TPSA | 56.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.22 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|