C19H23BF3KNO+ — CID 159762153
potassium [(2S,6S)-6-azaniumyl-5-oxo-1,7-diphenylheptan-2-yl]-trifluoroboranuide (PubChem CID 159762153) has the molecular formula C19H23BF3KNO+ and a molecular weight of 388.30 g/mol. Its IUPAC name is potassium [(2S,6S)-6-azaniumyl-5-oxo-1,7-diphenylheptan-2-yl]-trifluoroboranuide.
| Compound Name | potassium [(2S,6S)-6-azaniumyl-5-oxo-1,7-diphenylheptan-2-yl]-trifluoroboranuide |
|---|---|
| PubChem CID | 159762153 |
| Molecular Formula | C19H23BF3KNO+ |
| Molecular Weight | 388.30 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | potassium [(2S,6S)-6-azaniumyl-5-oxo-1,7-diphenylheptan-2-yl]-trifluoroboranuide |
| SMILES | [K+].[NH3+][C@@H](Cc1ccccc1)C(=O)CC[C@@H](Cc1ccccc1)[B-](F)(F)F |
| InChI | InChI=1S/C19H22BF3NO.K/c21-20(22,23)17(13-15-7-3-1-4-8-15)11-12-19(25)18(24)14-16-9-5-2-6-10-16;/h1-10,17-18H,11-14,24H2;/q-1;+1/p+1/t17-,18-;/m0./s1 |
| InChIKey | MOINNSHFGQAYAX-APTPAJQOSA-O |
| XLogP | 0.65 |
| TPSA | 44.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.30 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|