C22H20N6O2 — CID 163423914
5-nitro-N-[(1S)-1-phenylethyl]-2-(6-prop-2-enylimidazo[1,2-a]pyridin-3-yl)pyrimidin-4-amine (PubChem CID 163423914) has the molecular formula C22H20N6O2 and a molecular weight of 400.44 g/mol. Its IUPAC name is 5-nitro-N-[(1S)-1-phenylethyl]-2-(6-prop-2-enylimidazo[1,2-a]pyridin-3-yl)pyrimidin-4-amine.
| Compound Name | 5-nitro-N-[(1S)-1-phenylethyl]-2-(6-prop-2-enylimidazo[1,2-a]pyridin-3-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 163423914 |
| Molecular Formula | C22H20N6O2 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 5-nitro-N-[(1S)-1-phenylethyl]-2-(6-prop-2-enylimidazo[1,2-a]pyridin-3-yl)pyrimidin-4-amine |
| SMILES | C=CCc1ccc2ncc(-c3ncc([N+](=O)[O-])c(N[C@@H](C)c4ccccc4)n3)n2c1 |
| InChI | InChI=1S/C22H20N6O2/c1-3-7-16-10-11-20-23-12-18(27(20)14-16)21-24-13-19(28(29)30)22(26-21)25-15(2)17-8-5-4-6-9-17/h3-6,8-15H,1,7H2,2H3,(H,24,25,26)/t15-/m0/s1 |
| InChIKey | AKVQTROKHRPFKF-HNNXBMFYSA-N |
| XLogP | 4.60 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|