C36H22N4O2S4 — CID 163426872
2,8-bis[3-amino-5-(3-aminothiophen-2-yl)thiophen-2-yl]indeno[1,2-b]fluorene-6,12-dione (PubChem CID 163426872) has the molecular formula C36H22N4O2S4 and a molecular weight of 670.87 g/mol. Its IUPAC name is 2,8-bis[3-amino-5-(3-aminothiophen-2-yl)thiophen-2-yl]indeno[1,2-b]fluorene-6,12-dione.
| Compound Name | 2,8-bis[3-amino-5-(3-aminothiophen-2-yl)thiophen-2-yl]indeno[1,2-b]fluorene-6,12-dione |
|---|---|
| PubChem CID | 163426872 |
| Molecular Formula | C36H22N4O2S4 |
| Molecular Weight | 670.87 g/mol |
| Exact Mass | 670.06 |
| IUPAC Name | 2,8-bis[3-amino-5-(3-aminothiophen-2-yl)thiophen-2-yl]indeno[1,2-b]fluorene-6,12-dione |
| SMILES | Nc1cc(-c2sccc2N)sc1-c1ccc2c(c1)c(=O)c1cc3c(cc12)c(=O)c1cc(-c2sc(-c4sccc4N)cc2N)ccc13 |
| InChI | InChI=1S/C36H22N4O2S4/c37-25-5-7-43-35(25)29-13-27(39)33(45-29)15-1-3-17-19-11-24-20(12-23(19)31(41)21(17)9-15)18-4-2-16(10-22(18)32(24)42)34-28(40)14-30(46-34)36-26(38)6-8-44-36/h1-14H,37-40H2 |
| InChIKey | ANHDZGLDBCOYCW-UHFFFAOYSA-N |
| XLogP | 9.14 |
| TPSA | 138.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.87 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |