C30H25N3O3S — CID 163436533
16-N-[4-[(4-formylphenyl)methyl]-1,3-thiazol-2-yl]-16-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9,11,13-hexaene-3,16-dicarboxamide (PubChem CID 163436533) has the molecular formula C30H25N3O3S and a molecular weight of 507.62 g/mol. Its IUPAC name is 16-N-[4-[(4-formylphenyl)methyl]-1,3-thiazol-2-yl]-16-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9,11,13-hexaene-3,16-dicarboxamide.
| Compound Name | 16-N-[4-[(4-formylphenyl)methyl]-1,3-thiazol-2-yl]-16-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9,11,13-hexaene-3,16-dicarboxamide |
|---|---|
| PubChem CID | 163436533 |
| Molecular Formula | C30H25N3O3S |
| Molecular Weight | 507.62 g/mol |
| Exact Mass | 507.16 |
| IUPAC Name | 16-N-[4-[(4-formylphenyl)methyl]-1,3-thiazol-2-yl]-16-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9,11,13-hexaene-3,16-dicarboxamide |
| SMILES | CC1(C(=O)Nc2nc(Cc3ccc(C=O)cc3)cs2)CC2c3ccccc3C1c1cccc(C(N)=O)c12 |
| InChI | InChI=1S/C30H25N3O3S/c1-30(28(36)33-29-32-19(16-37-29)13-17-9-11-18(15-34)12-10-17)14-24-20-5-2-3-6-21(20)26(30)22-7-4-8-23(25(22)24)27(31)35/h2-12,15-16,24,26H,13-14H2,1H3,(H2,31,35)(H,32,33,36) |
| InChIKey | AUYYBPCEVMGSAR-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.62 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|