C8H6F6S — CID 163440773
6-methyl-3,5-bis(trifluoromethyl)-2H-thiopyran (PubChem CID 163440773) has the molecular formula C8H6F6S and a molecular weight of 248.19 g/mol. Its IUPAC name is 6-methyl-3,5-bis(trifluoromethyl)-2H-thiopyran.
| Compound Name | 6-methyl-3,5-bis(trifluoromethyl)-2H-thiopyran |
|---|---|
| PubChem CID | 163440773 |
| Molecular Formula | C8H6F6S |
| Molecular Weight | 248.19 g/mol |
| Exact Mass | 248.01 |
| IUPAC Name | 6-methyl-3,5-bis(trifluoromethyl)-2H-thiopyran |
| SMILES | CC1=C(C(F)(F)F)C=C(C(F)(F)F)CS1 |
| InChI | InChI=1S/C8H6F6S/c1-4-6(8(12,13)14)2-5(3-15-4)7(9,10)11/h2H,3H2,1H3 |
| InChIKey | DWYKEDKMRYJPDS-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.19 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |