C10H6F4S — CID 123171106
5-fluoro-6-(trifluoromethyl)-8aH-thiochromene (PubChem CID 123171106) has the molecular formula C10H6F4S and a molecular weight of 234.22 g/mol. Its IUPAC name is 5-fluoro-6-(trifluoromethyl)-8aH-thiochromene.
| Compound Name | 5-fluoro-6-(trifluoromethyl)-8aH-thiochromene |
|---|---|
| PubChem CID | 123171106 |
| Molecular Formula | C10H6F4S |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.01 |
| IUPAC Name | 5-fluoro-6-(trifluoromethyl)-8aH-thiochromene |
| SMILES | FC1=C(C(F)(F)F)C=CC2SC=CC=C12 |
| InChI | InChI=1S/C10H6F4S/c11-9-6-2-1-5-15-8(6)4-3-7(9)10(12,13)14/h1-5,8H |
| InChIKey | AXHRUXXFGWYGPF-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |