C9H15N2O14P3+2 — CID 163443401
[[[(2R,3S,4R,5S)-5-(2-carbamoyl-1,3-oxazol-4-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-oxophosphaniumyl]oxy-trihydroxyphosphanium (PubChem CID 163443401) has the molecular formula C9H15N2O14P3+2 and a molecular weight of 468.14 g/mol. Its IUPAC name is [[[(2R,3S,4R,5S)-5-(2-carbamoyl-1,3-oxazol-4-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-oxophosphaniumyl]oxy-trihydroxyphosphanium.
| Compound Name | [[[(2R,3S,4R,5S)-5-(2-carbamoyl-1,3-oxazol-4-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-oxophosphaniumyl]oxy-trihydroxyphosphanium |
|---|---|
| PubChem CID | 163443401 |
| Molecular Formula | C9H15N2O14P3+2 |
| Molecular Weight | 468.14 g/mol |
| Exact Mass | 467.97 |
| IUPAC Name | [[[(2R,3S,4R,5S)-5-(2-carbamoyl-1,3-oxazol-4-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-oxophosphaniumyl]oxy-trihydroxyphosphanium |
| SMILES | NC(=O)c1nc([C@@H]2O[C@H](COP(=O)(O)O[P+](=O)O[P+](O)(O)O)[C@@H](O)[C@H]2O)co1 |
| InChI | InChI=1S/C9H13N2O14P3/c10-8(14)9-11-3(1-21-9)7-6(13)5(12)4(23-7)2-22-28(19,20)25-26(15)24-27(16,17)18/h1,4-7,12-13,16-18H,2H2,(H-2,10,14,19,20)/p+2/t4-,5-,6-,7+/m1/s1 |
| InChIKey | BAMBTBHQKSCNMK-GBNDHIKLSA-P |
| XLogP | -1.60 |
| TPSA | 261.56 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.14 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|