C11H18N3O9P — CID 135455444
[5-(5-carbamoyl-4-hydroxy-1H-pyrazol-3-yl)-3,4-dihydroxyoxolan-2-yl]methyl dimethyl phosphate (PubChem CID 135455444) has the molecular formula C11H18N3O9P and a molecular weight of 367.25 g/mol. Its IUPAC name is [5-(5-carbamoyl-4-hydroxy-1H-pyrazol-3-yl)-3,4-dihydroxyoxolan-2-yl]methyl dimethyl phosphate.
| Compound Name | [5-(5-carbamoyl-4-hydroxy-1H-pyrazol-3-yl)-3,4-dihydroxyoxolan-2-yl]methyl dimethyl phosphate |
|---|---|
| PubChem CID | 135455444 |
| Molecular Formula | C11H18N3O9P |
| Molecular Weight | 367.25 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | [5-(5-carbamoyl-4-hydroxy-1H-pyrazol-3-yl)-3,4-dihydroxyoxolan-2-yl]methyl dimethyl phosphate |
| SMILES | COP(=O)(OC)OCC1OC(c2n[nH]c(C(N)=O)c2O)C(O)C1O |
| InChI | InChI=1S/C11H18N3O9P/c1-20-24(19,21-2)22-3-4-7(15)9(17)10(23-4)5-8(16)6(11(12)18)14-13-5/h4,7,9-10,15-17H,3H2,1-2H3,(H2,12,18)(H,13,14) |
| InChIKey | BZZHKADBDAZTIU-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 186.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.25 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|