C18H13N — CID 163458762
8-phenyl-2-azatricyclo[7.4.0.03,5]trideca-1(13),2,5,7,9,11-hexaene (PubChem CID 163458762) has the molecular formula C18H13N and a molecular weight of 243.31 g/mol. Its IUPAC name is 8-phenyl-2-azatricyclo[7.4.0.03,5]trideca-1(13),2,5,7,9,11-hexaene.
| Compound Name | 8-phenyl-2-azatricyclo[7.4.0.03,5]trideca-1(13),2,5,7,9,11-hexaene |
|---|---|
| PubChem CID | 163458762 |
| Molecular Formula | C18H13N |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 8-phenyl-2-azatricyclo[7.4.0.03,5]trideca-1(13),2,5,7,9,11-hexaene |
| SMILES | C1=C2C/C2=N/c2ccccc2C(c2ccccc2)=C1 |
| InChI | InChI=1S/C18H13N/c1-2-6-13(7-3-1)15-11-10-14-12-18(14)19-17-9-5-4-8-16(15)17/h1-11H,12H2/b11-10?,14-10?,15-11?,16-15?,19-17-,19-18- |
| InChIKey | BMTOXDAYAZIKBN-RUIPWFKDSA-N |
| XLogP | 4.53 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |