C15H20N2 — CID 163459768
3-propan-2-yl-2,3,4,9-tetrahydro-1H-carbazol-1-amine (PubChem CID 163459768) has the molecular formula C15H20N2 and a molecular weight of 228.34 g/mol. Its IUPAC name is 3-propan-2-yl-2,3,4,9-tetrahydro-1H-carbazol-1-amine.
| Compound Name | 3-propan-2-yl-2,3,4,9-tetrahydro-1H-carbazol-1-amine |
|---|---|
| PubChem CID | 163459768 |
| Molecular Formula | C15H20N2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | 3-propan-2-yl-2,3,4,9-tetrahydro-1H-carbazol-1-amine |
| SMILES | CC(C)C1Cc2c([nH]c3ccccc23)C(N)C1 |
| InChI | InChI=1S/C15H20N2/c1-9(2)10-7-12-11-5-3-4-6-14(11)17-15(12)13(16)8-10/h3-6,9-10,13,17H,7-8,16H2,1-2H3 |
| InChIKey | BNORNQQQIDXMBA-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|