C11H19N2O4- — CID 163464234
tert-butyl (2R)-2-[methoxy(oxido)amino]-4-methyl-2,3-dihydropyrrole-1-carboxylate (PubChem CID 163464234) has the molecular formula C11H19N2O4- and a molecular weight of 243.28 g/mol. Its IUPAC name is tert-butyl (2R)-2-[methoxy(oxido)amino]-4-methyl-2,3-dihydropyrrole-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-[methoxy(oxido)amino]-4-methyl-2,3-dihydropyrrole-1-carboxylate |
|---|---|
| PubChem CID | 163464234 |
| Molecular Formula | C11H19N2O4- |
| Molecular Weight | 243.28 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | tert-butyl (2R)-2-[methoxy(oxido)amino]-4-methyl-2,3-dihydropyrrole-1-carboxylate |
| SMILES | CON([O-])[C@@H]1CC(C)=CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H19N2O4/c1-8-6-9(13(15)16-5)12(7-8)10(14)17-11(2,3)4/h7,9H,6H2,1-5H3/q-1/t9-/m1/s1 |
| InChIKey | YZACWOMIPXCZIV-SECBINFHSA-N |
| XLogP | 2.22 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.28 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|