C10H20N2O2 — CID 163467215
9-N-methyl-1,5-dioxaspiro[5.5]undecane-3,9-diamine (PubChem CID 163467215) has the molecular formula C10H20N2O2 and a molecular weight of 200.28 g/mol. Its IUPAC name is 9-N-methyl-1,5-dioxaspiro[5.5]undecane-3,9-diamine.
| Compound Name | 9-N-methyl-1,5-dioxaspiro[5.5]undecane-3,9-diamine |
|---|---|
| PubChem CID | 163467215 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | 9-N-methyl-1,5-dioxaspiro[5.5]undecane-3,9-diamine |
| SMILES | CNC1CCC2(CC1)OCC(N)CO2 |
| InChI | InChI=1S/C10H20N2O2/c1-12-9-2-4-10(5-3-9)13-6-8(11)7-14-10/h8-9,12H,2-7,11H2,1H3 |
| InChIKey | BTPMKEFISQEVQF-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |