C10H19IS — CID 163483984
cis-(2S,3S)-2-iodo-3-methyl-2-propan-2-ylcyclohexane-1-thiol (PubChem CID 163483984) has the molecular formula C10H19IS and a molecular weight of 298.23 g/mol. Its IUPAC name is cis-(2S,3S)-2-iodo-3-methyl-2-propan-2-ylcyclohexane-1-thiol.
| Compound Name | cis-(2S,3S)-2-iodo-3-methyl-2-propan-2-ylcyclohexane-1-thiol |
|---|---|
| PubChem CID | 163483984 |
| Molecular Formula | C10H19IS |
| Molecular Weight | 298.23 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | cis-(2S,3S)-2-iodo-3-methyl-2-propan-2-ylcyclohexane-1-thiol |
| SMILES | CC(C)[C@@]1(I)C(S)CCC[C@@H]1C |
| InChI | InChI=1S/C10H19IS/c1-7(2)10(11)8(3)5-4-6-9(10)12/h7-9,12H,4-6H2,1-3H3/t8-,9?,10-/m0/s1 |
| InChIKey | CGYPIEPMZKWFTB-SMILAEQMSA-N |
| XLogP | 3.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.23 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|