C9H14 — CID 163485393
(3S,6S)-3-propan-2-yltricyclo[3.1.0.02,6]hexane (PubChem CID 163485393) has the molecular formula C9H14 and a molecular weight of 122.21 g/mol. Its IUPAC name is (3S,6S)-3-propan-2-yltricyclo[3.1.0.02,6]hexane.
| Compound Name | (3S,6S)-3-propan-2-yltricyclo[3.1.0.02,6]hexane |
|---|---|
| PubChem CID | 163485393 |
| Molecular Formula | C9H14 |
| Molecular Weight | 122.21 g/mol |
| Exact Mass | 122.11 |
| IUPAC Name | (3S,6S)-3-propan-2-yltricyclo[3.1.0.02,6]hexane |
| SMILES | CC(C)[C@@H]1CC2C3C1[C@@H]23 |
| InChI | InChI=1S/C9H14/c1-4(2)5-3-6-8-7(5)9(6)8/h4-9H,3H2,1-2H3/t5-,6?,7?,8+,9?/m0/s1 |
| InChIKey | CICWYOGXSWQENP-UFSSTMQVSA-N |
| XLogP | 2.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 122.21 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |