C21H37IN3O4S- — CID 163495761
2,2,4-trimethyl-N-[5-(methylamino)-6-oxoheptyl]-4-(1-methyliodanuidyl-2,5-dioxopyrrolidin-3-yl)sulfanylpentanamide (PubChem CID 163495761) has the molecular formula C21H37IN3O4S- and a molecular weight of 554.52 g/mol. Its IUPAC name is 2,2,4-trimethyl-N-[5-(methylamino)-6-oxoheptyl]-4-(1-methyliodanuidyl-2,5-dioxopyrrolidin-3-yl)sulfanylpentanamide.
| Compound Name | 2,2,4-trimethyl-N-[5-(methylamino)-6-oxoheptyl]-4-(1-methyliodanuidyl-2,5-dioxopyrrolidin-3-yl)sulfanylpentanamide |
|---|---|
| PubChem CID | 163495761 |
| Molecular Formula | C21H37IN3O4S- |
| Molecular Weight | 554.52 g/mol |
| Exact Mass | 554.16 |
| IUPAC Name | 2,2,4-trimethyl-N-[5-(methylamino)-6-oxoheptyl]-4-(1-methyliodanuidyl-2,5-dioxopyrrolidin-3-yl)sulfanylpentanamide |
| SMILES | CNC(CCCCNC(=O)C(C)(C)CC(C)(C)SC1CC(=O)N([I-]C)C1=O)C(C)=O |
| InChI | InChI=1S/C21H37IN3O4S/c1-14(26)15(23-7)10-8-9-11-24-19(29)20(2,3)13-21(4,5)30-16-12-17(27)25(22-6)18(16)28/h15-16,23H,8-13H2,1-7H3,(H,24,29)/q-1 |
| InChIKey | FRMJJFVRWGVMNA-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.52 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|