C20H35IN3O4S- — CID 148750108
2,2,4-trimethyl-N-[4-(methylamino)-5-oxohexyl]-4-(1-methyliodanuidyl-2,5-dioxopyrrolidin-3-yl)sulfanylpentanamide (PubChem CID 148750108) has the molecular formula C20H35IN3O4S- and a molecular weight of 540.49 g/mol. Its IUPAC name is 2,2,4-trimethyl-N-[4-(methylamino)-5-oxohexyl]-4-(1-methyliodanuidyl-2,5-dioxopyrrolidin-3-yl)sulfanylpentanamide.
| Compound Name | 2,2,4-trimethyl-N-[4-(methylamino)-5-oxohexyl]-4-(1-methyliodanuidyl-2,5-dioxopyrrolidin-3-yl)sulfanylpentanamide |
|---|---|
| PubChem CID | 148750108 |
| Molecular Formula | C20H35IN3O4S- |
| Molecular Weight | 540.49 g/mol |
| Exact Mass | 540.14 |
| IUPAC Name | 2,2,4-trimethyl-N-[4-(methylamino)-5-oxohexyl]-4-(1-methyliodanuidyl-2,5-dioxopyrrolidin-3-yl)sulfanylpentanamide |
| SMILES | CNC(CCCNC(=O)C(C)(C)CC(C)(C)SC1CC(=O)N([I-]C)C1=O)C(C)=O |
| InChI | InChI=1S/C20H35IN3O4S/c1-13(25)14(22-7)9-8-10-23-18(28)19(2,3)12-20(4,5)29-15-11-16(26)24(21-6)17(15)27/h14-15,22H,8-12H2,1-7H3,(H,23,28)/q-1 |
| InChIKey | GKDUDNSSPPHXEO-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.49 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|