C14H24N2O — CID 163495945
4-anilino-N,N,2,3-tetramethylbutan-2-amine oxide (PubChem CID 163495945) has the molecular formula C14H24N2O and a molecular weight of 236.36 g/mol. Its IUPAC name is 4-anilino-N,N,2,3-tetramethylbutan-2-amine oxide.
| Compound Name | 4-anilino-N,N,2,3-tetramethylbutan-2-amine oxide |
|---|---|
| PubChem CID | 163495945 |
| Molecular Formula | C14H24N2O |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | 4-anilino-N,N,2,3-tetramethylbutan-2-amine oxide |
| SMILES | CC(CNc1ccccc1)C(C)(C)[N+](C)(C)[O-] |
| InChI | InChI=1S/C14H24N2O/c1-12(14(2,3)16(4,5)17)11-15-13-9-7-6-8-10-13/h6-10,12,15H,11H2,1-5H3 |
| InChIKey | CQSIVKWAMRDPOS-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 35.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|