C36H32O8Si — CID 163504792
3-[4-[[4-(5,7-dimethoxy-2-oxochromen-3-yl)phenyl]-dimethylsilyl]phenyl]-5,7-dimethoxychromen-2-one (PubChem CID 163504792) has the molecular formula C36H32O8Si and a molecular weight of 620.73 g/mol. Its IUPAC name is 3-[4-[[4-(5,7-dimethoxy-2-oxochromen-3-yl)phenyl]-dimethylsilyl]phenyl]-5,7-dimethoxychromen-2-one.
| Compound Name | 3-[4-[[4-(5,7-dimethoxy-2-oxochromen-3-yl)phenyl]-dimethylsilyl]phenyl]-5,7-dimethoxychromen-2-one |
|---|---|
| PubChem CID | 163504792 |
| Molecular Formula | C36H32O8Si |
| Molecular Weight | 620.73 g/mol |
| Exact Mass | 620.19 |
| IUPAC Name | 3-[4-[[4-(5,7-dimethoxy-2-oxochromen-3-yl)phenyl]-dimethylsilyl]phenyl]-5,7-dimethoxychromen-2-one |
| SMILES | COc1cc(OC)c2cc(-c3ccc([Si](C)(C)c4ccc(-c5cc6c(OC)cc(OC)cc6oc5=O)cc4)cc3)c(=O)oc2c1 |
| InChI | InChI=1S/C36H32O8Si/c1-39-23-15-31(41-3)29-19-27(35(37)43-33(29)17-23)21-7-11-25(12-8-21)45(5,6)26-13-9-22(10-14-26)28-20-30-32(42-4)16-24(40-2)18-34(30)44-36(28)38/h7-20H,1-6H3 |
| InChIKey | CXRLENYSMZBZHD-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 97.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.73 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|