C13H10N2O4S — CID 129279523
6,8-dimethoxy-2-sulfanylidenechromeno[2,3-d]pyrimidin-4-one (PubChem CID 129279523) has the molecular formula C13H10N2O4S and a molecular weight of 290.30 g/mol. Its IUPAC name is 6,8-dimethoxy-2-sulfanylidenechromeno[2,3-d]pyrimidin-4-one.
| Compound Name | 6,8-dimethoxy-2-sulfanylidenechromeno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 129279523 |
| Molecular Formula | C13H10N2O4S |
| Molecular Weight | 290.30 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | 6,8-dimethoxy-2-sulfanylidenechromeno[2,3-d]pyrimidin-4-one |
| SMILES | COc1cc(OC)c2cc3c(=O)[nH]c(=S)nc-3oc2c1 |
| InChI | InChI=1S/C13H10N2O4S/c1-17-6-3-9(18-2)7-5-8-11(16)14-13(20)15-12(8)19-10(7)4-6/h3-5H,1-2H3,(H,14,16,20) |
| InChIKey | FZYGAYXYTXHBRG-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.30 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|