C15H17N2+ — CID 163508612
3-ethyl-2,9-dimethylimidazo[1,5-b]isoquinolin-2-ium (PubChem CID 163508612) has the molecular formula C15H17N2+ and a molecular weight of 225.31 g/mol. Its IUPAC name is 3-ethyl-2,9-dimethylimidazo[1,5-b]isoquinolin-2-ium.
| Compound Name | 3-ethyl-2,9-dimethylimidazo[1,5-b]isoquinolin-2-ium |
|---|---|
| PubChem CID | 163508612 |
| Molecular Formula | C15H17N2+ |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | 3-ethyl-2,9-dimethylimidazo[1,5-b]isoquinolin-2-ium |
| SMILES | CCc1n2cc3cccc(C)c3cc2c[n+]1C |
| InChI | InChI=1S/C15H17N2/c1-4-15-16(3)10-13-8-14-11(2)6-5-7-12(14)9-17(13)15/h5-10H,4H2,1-3H3/q+1 |
| InChIKey | WZTUOZBXYQXIAW-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 8.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|