C24H35N6O6P — CID 163533217
N-methyl-9-[(2R)-2-[[(2-methylphenyl)methoxy-[[(2R)-1-oxo-1-propan-2-yloxypropan-2-yl]amino]phosphoryl]methoxy]propyl]purin-6-amine oxide (PubChem CID 163533217) has the molecular formula C24H35N6O6P and a molecular weight of 534.55 g/mol. Its IUPAC name is N-methyl-9-[(2R)-2-[[(2-methylphenyl)methoxy-[[(2R)-1-oxo-1-propan-2-yloxypropan-2-yl]amino]phosphoryl]methoxy]propyl]purin-6-amine oxide.
| Compound Name | N-methyl-9-[(2R)-2-[[(2-methylphenyl)methoxy-[[(2R)-1-oxo-1-propan-2-yloxypropan-2-yl]amino]phosphoryl]methoxy]propyl]purin-6-amine oxide |
|---|---|
| PubChem CID | 163533217 |
| Molecular Formula | C24H35N6O6P |
| Molecular Weight | 534.55 g/mol |
| Exact Mass | 534.24 |
| IUPAC Name | N-methyl-9-[(2R)-2-[[(2-methylphenyl)methoxy-[[(2R)-1-oxo-1-propan-2-yloxypropan-2-yl]amino]phosphoryl]methoxy]propyl]purin-6-amine oxide |
| SMILES | Cc1ccccc1CO[P@](=O)(CO[C@H](C)Cn1cnc2c([NH+](C)[O-])ncnc21)N[C@H](C)C(=O)OC(C)C |
| InChI | InChI=1S/C24H35N6O6P/c1-16(2)36-24(31)19(5)28-37(33,35-12-20-10-8-7-9-17(20)3)15-34-18(4)11-30-14-27-21-22(29(6)32)25-13-26-23(21)30/h7-10,13-14,16,18-19,29H,11-12,15H2,1-6H3,(H,28,33)/t18-,19-,37-/m1/s1 |
| InChIKey | DUTAGDJRSUDCMZ-AJGZLTHWSA-N |
| XLogP | 2.48 |
| TPSA | 144.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.55 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|