C9H13N2O2- — CID 163533278
N-[4,5-dimethyl-2-(methylamino)phenyl]-N-oxidohydroxylamine (PubChem CID 163533278) has the molecular formula C9H13N2O2- and a molecular weight of 181.21 g/mol. Its IUPAC name is N-[4,5-dimethyl-2-(methylamino)phenyl]-N-oxidohydroxylamine.
| Compound Name | N-[4,5-dimethyl-2-(methylamino)phenyl]-N-oxidohydroxylamine |
|---|---|
| PubChem CID | 163533278 |
| Molecular Formula | C9H13N2O2- |
| Molecular Weight | 181.21 g/mol |
| Exact Mass | 181.10 |
| IUPAC Name | N-[4,5-dimethyl-2-(methylamino)phenyl]-N-oxidohydroxylamine |
| SMILES | CNc1cc(C)c(C)cc1N([O-])O |
| InChI | InChI=1S/C9H13N2O2/c1-6-4-8(10-3)9(11(12)13)5-7(6)2/h4-5,10,12H,1-3H3/q-1 |
| InChIKey | OFOIMNZMYGVSJC-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.21 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|